CAS 2237235-32-2 appears in our catalog under these names: 6-Chloro-N-[(4-methoxyphenyl)methyl]-4-methylpyridin-2-amine, 95%, 6-Chloro-N-((4-methoxyphenyl)methyl)-4-methylpyridin-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 10g.
6-chloro-N-[(4-methoxyphenyl)methyl]-4-methylpyridin-2-amine (CAS 2237235-32-2) is a chemical compound with the molecular formula C14H15ClN2O and a molecular weight of 262.73 g/mol. IUPAC name: 6-chloro-N-[(4-methoxyphenyl)methyl]-4-methylpyridin-2-amine. InChIKey: SDOLZBBCURISAY-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O |
|---|---|
| Molecular weight | 262.73 g/mol |
| IUPAC name | 6-chloro-N-[(4-methoxyphenyl)methyl]-4-methylpyridin-2-amine |
| InChIKey | SDOLZBBCURISAY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1)Cl)NCC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)