CAS 923975-81-9 appears in our catalog under these names: 3-(4-Chlorophenyl)-1,4-diazaspiro[4.5]dec-3-en-2-one, 90%, 3–(4–Chlorophenyl)–1,4–diazaspiro–(4·5)dec–3–en–2–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 500mg.
3-(4-chlorophenyl)-1,4-diazaspiro[4.5]dec-3-en-2-one (CAS 923975-81-9) is a chemical compound with the molecular formula C14H15ClN2O and a molecular weight of 262.73 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,4-diazaspiro[4.5]dec-3-en-2-one. InChIKey: MCJKYGYSKUJURQ-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O |
|---|---|
| Molecular weight | 262.73 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,4-diazaspiro[4.5]dec-3-en-2-one |
| InChIKey | MCJKYGYSKUJURQ-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)NC(=O)C(=N2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)