Products 114431-62-8
CAS 114431-62-8 is the registry number for 3-(8-Amino-1,3-dimethyl-2,6-dioxo-2,3-dihydro-1H-purin-7(6H)-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
3-(8-amino-1,3-dimethyl-2,6-dioxopurin-7-yl)propanoic acid (CAS 114431-62-8) is a chemical compound with the molecular formula C10H13N5O4 and a molecular weight of 267.24 g/mol. IUPAC name: 3-(8-amino-1,3-dimethyl-2,6-dioxopurin-7-yl)propanoic acid. InChIKey: BXQVVDJZCDTBBB-UHFFFAOYSA-N.
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 3-(8-amino-1,3-dimethyl-2,6-dioxopurin-7-yl)propanoic acid |
| InChIKey | BXQVVDJZCDTBBB-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C(=N2)N)CCC(=O)O |
Computed by PubChem (NCBI)