CAS 1144465-02-0 appears in our catalog under these names: 2-[(5-Amino-1h-1,2,4-triazol-1-yl)methyl]succinic acid, 95%, 2-((5-Amino-1H-1,2,4-triazol-1-yl)methyl)succinic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-[(5-amino-1,2,4-triazol-1-yl)methyl]butanedioic acid (CAS 1144465-02-0) is a chemical compound with the molecular formula C7H10N4O4 and a molecular weight of 214.18 g/mol. IUPAC name: 2-[(5-amino-1,2,4-triazol-1-yl)methyl]butanedioic acid. InChIKey: HOZPQKAFTAJFJI-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O4 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 2-[(5-amino-1,2,4-triazol-1-yl)methyl]butanedioic acid |
| InChIKey | HOZPQKAFTAJFJI-UHFFFAOYSA-N |
| SMILES | C1=NN(C(=N1)N)CC(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)