CAS 31478-45-2 is the registry number for 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2-methyl-5-nitroimidazol-1-yl)ethyl carbamate (CAS 31478-45-2) is a chemical compound with the molecular formula C7H10N4O4 and a molecular weight of 214.18 g/mol. IUPAC name: 2-(2-methyl-5-nitroimidazol-1-yl)ethyl carbamate. InChIKey: JOVXEDBYAWFQQX-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O4 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl carbamate |
| InChIKey | JOVXEDBYAWFQQX-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1CCOC(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)