CAS 13992-53-5 is the registry number for 1,3-Dimethyl-6-methylamino-5-nitro-1H-pyrimidine-2,4-dione, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1,3-dimethyl-6-(methylamino)-5-nitropyrimidine-2,4-dione (CAS 13992-53-5) is a chemical compound with the molecular formula C7H10N4O4 and a molecular weight of 214.18 g/mol. IUPAC name: 1,3-dimethyl-6-(methylamino)-5-nitropyrimidine-2,4-dione. InChIKey: YPENWWBLQQJRDL-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O4 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 1,3-dimethyl-6-(methylamino)-5-nitropyrimidine-2,4-dione |
| InChIKey | YPENWWBLQQJRDL-UHFFFAOYSA-N |
| SMILES | CNC1=C(C(=O)N(C(=O)N1C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)