CAS 887570-33-4 is the registry number for Methyl (6-(methylamino)-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl N-[6-(methylamino)-2,4-dioxo-1H-pyrimidin-5-yl]carbamate (CAS 887570-33-4) is a chemical compound with the molecular formula C7H10N4O4 and a molecular weight of 214.18 g/mol. IUPAC name: methyl N-[6-(methylamino)-2,4-dioxo-1H-pyrimidin-5-yl]carbamate. InChIKey: WVEHCZRQQHKOEE-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O4 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | methyl N-[6-(methylamino)-2,4-dioxo-1H-pyrimidin-5-yl]carbamate |
| InChIKey | WVEHCZRQQHKOEE-UHFFFAOYSA-N |
| SMILES | CNC1=C(C(=O)NC(=O)N1)NC(=O)OC |
Computed by PubChem (NCBI)