Products 132786-90-4

CAS 132786-90-4 is the registry number for 4,6-dimethoxy-1,3,5-triazin-2-yl-glycine, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]acetic acid (CAS 132786-90-4) is a chemical compound with the molecular formula C7H10N4O4 and a molecular weight of 214.18 g/mol. IUPAC name: 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]acetic acid. InChIKey: UBZCDHDFCBCZHG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10N4O4
Molecular weight214.18 g/mol
IUPAC name2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]acetic acid
InChIKeyUBZCDHDFCBCZHG-UHFFFAOYSA-N
SMILESCOC1=NC(=NC(=N1)NCC(=O)O)OC

Computed by PubChem (NCBI)