CAS 887570-48-1 is the registry number for 6-(Ethylamino)-3-methyl-5-nitropyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(ethylamino)-3-methyl-5-nitro-1H-pyrimidine-2,4-dione (CAS 887570-48-1) is a chemical compound with the molecular formula C7H10N4O4 and a molecular weight of 214.18 g/mol. IUPAC name: 6-(ethylamino)-3-methyl-5-nitro-1H-pyrimidine-2,4-dione. InChIKey: XDLRGGOOLPRLIJ-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O4 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 6-(ethylamino)-3-methyl-5-nitro-1H-pyrimidine-2,4-dione |
| InChIKey | XDLRGGOOLPRLIJ-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C(=O)N(C(=O)N1)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)