CAS 34259-84-2 appears in our catalog under these names: 1-[(4-nitrophenyl)carbonyl]piperidin-4-one, 95%, 1-(4-Nitrobenzoyl)piperidin-4-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,05g, 0,1g, 0,25g, 0,5g.
1-(4-nitrobenzoyl)piperidin-4-one (CAS 34259-84-2) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: 1-(4-nitrobenzoyl)piperidin-4-one. InChIKey: LQQFSAFLSZJSEH-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 1-(4-nitrobenzoyl)piperidin-4-one |
| InChIKey | LQQFSAFLSZJSEH-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)C(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)