Products 1147-64-4

CAS 1147-64-4 is the registry number for 4-(4,5-Dichloro-6-oxo-1,6-dihydropyridazin-1-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

4-(4,5-dichloro-6-oxopyridazin-1-yl)benzoic acid (CAS 1147-64-4) is a chemical compound with the molecular formula C11H6Cl2N2O3 and a molecular weight of 285.08 g/mol. IUPAC name: 4-(4,5-dichloro-6-oxopyridazin-1-yl)benzoic acid. InChIKey: PAXANYFYBRBZOE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H6Cl2N2O3
Molecular weight285.08 g/mol
IUPAC name4-(4,5-dichloro-6-oxopyridazin-1-yl)benzoic acid
InChIKeyPAXANYFYBRBZOE-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)O)N2C(=O)C(=C(C=N2)Cl)Cl

Computed by PubChem (NCBI)