Products 1184088-66-1
CAS 1184088-66-1 is the registry number for 6-(2,3-Dichlorophenoxy)pyridazine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(2,3-dichlorophenoxy)pyridazine-3-carboxylic acid (CAS 1184088-66-1) is a chemical compound with the molecular formula C11H6Cl2N2O3 and a molecular weight of 285.08 g/mol. IUPAC name: 6-(2,3-dichlorophenoxy)pyridazine-3-carboxylic acid. InChIKey: VPYYBRNGTASUCJ-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2N2O3 |
|---|---|
| Molecular weight | 285.08 g/mol |
| IUPAC name | 6-(2,3-dichlorophenoxy)pyridazine-3-carboxylic acid |
| InChIKey | VPYYBRNGTASUCJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)OC2=NN=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)