Products 1148050-30-9
CAS 1148050-30-9 appears in our catalog under these names: 3-(4-Bromophenyl)-1,1,1-trifluoro-2-propanol, 97%, 3–(4–Bromophenyl)–1，1，1–trifluoro–2–propanol. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g.
3-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol (CAS 1148050-30-9) is a chemical compound with the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. IUPAC name: 3-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol. InChIKey: NUQKLBWHNGSIIU-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O |
|---|---|
| Molecular weight | 269.06 g/mol |
| IUPAC name | 3-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol |
| InChIKey | NUQKLBWHNGSIIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(F)(F)F)O)Br |
Computed by PubChem (NCBI)