CAS 114829-12-8 appears in our catalog under these names: (2S)-2-Amino-4,4,4-trifluoro-3-phenylbutanoic acid, 97%, beta-(Trifluoromethyl)phenylalanine. Offered by: AmBeed, TRC. Available pack sizes: 1g, 250mg.
2-amino-4,4,4-trifluoro-3-phenylbutanoic acid (CAS 114829-12-8) is a chemical compound with the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. IUPAC name: 2-amino-4,4,4-trifluoro-3-phenylbutanoic acid. InChIKey: HCFBWJOBUKKGCG-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO2 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | 2-amino-4,4,4-trifluoro-3-phenylbutanoic acid |
| InChIKey | HCFBWJOBUKKGCG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)