CAS 114897-92-6 appears in our catalog under these names: 4–Bromo–2–fluorophenylacetic acid, 4-Bromo-2-fluorophenylacetic acid, 98% , 4-Bromo-2-fluorophenylacetic acid 98%, 2-(4-Bromo-2-fluorophenyl)acetic Acid, 98%, 98%, 4-Bromo-2-fluorophenylacetic acid, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 500g.
2-(4-bromo-2-fluorophenyl)acetic acid (CAS 114897-92-6) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-(4-bromo-2-fluorophenyl)acetic acid. InChIKey: PNBIYFPZODYMOO-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-(4-bromo-2-fluorophenyl)acetic acid |
| InChIKey | PNBIYFPZODYMOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)CC(=O)O |
Computed by PubChem (NCBI)