Products 1150164-31-0
CAS 1150164-31-0 is the registry number for Ethyl 1-(3-chloropyridin-2-yl)-5-methylpyrazole-4-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Ethyl 1-(3-chloro-2-pyridinyl)-5-methylpyrazole-4-carboxylate (CAS 1150164-31-0) is a chemical compound with the molecular formula C12H12ClN3O2 and a molecular weight of 265.69 g/mol. IUPAC name: ethyl 1-(3-chloro-2-pyridinyl)-5-methylpyrazole-4-carboxylate. InChIKey: DRAKSNGEBKYYIY-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O2 |
|---|---|
| Molecular weight | 265.69 g/mol |
| IUPAC name | ethyl 1-(3-chloro-2-pyridinyl)-5-methylpyrazole-4-carboxylate |
| InChIKey | DRAKSNGEBKYYIY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=C(C=CC=N2)Cl)C |
Computed by PubChem (NCBI)