CAS 2279121-95-6 is the registry number for 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-n,n-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N,N-dimethylbenzamide (CAS 2279121-95-6) is a chemical compound with the molecular formula C12H12ClN3O2 and a molecular weight of 265.69 g/mol. IUPAC name: 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N,N-dimethylbenzamide. InChIKey: WBXGCCLMCMWXPX-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O2 |
|---|---|
| Molecular weight | 265.69 g/mol |
| IUPAC name | 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N,N-dimethylbenzamide |
| InChIKey | WBXGCCLMCMWXPX-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=CC(=C1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)