CAS 837423-56-0 is the registry number for 2-Chloro-n-(2,4-dimethoxyphenyl)pyrimidin-4-amine, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-chloro-N-(2,4-dimethoxyphenyl)pyrimidin-4-amine (CAS 837423-56-0) is a chemical compound with the molecular formula C12H12ClN3O2 and a molecular weight of 265.69 g/mol. IUPAC name: 2-chloro-N-(2,4-dimethoxyphenyl)pyrimidin-4-amine. InChIKey: WIAYOVNMHFHMSM-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O2 |
|---|---|
| Molecular weight | 265.69 g/mol |
| IUPAC name | 2-chloro-N-(2,4-dimethoxyphenyl)pyrimidin-4-amine |
| InChIKey | WIAYOVNMHFHMSM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)NC2=NC(=NC=C2)Cl)OC |
Computed by PubChem (NCBI)