Products 91396-27-9
CAS 91396-27-9 is the registry number for Ethyl 1-(4-chlorophenyl)-5-methyl-1h-1,2,4-triazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Ethyl 1-(4-chlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylate (CAS 91396-27-9) is a chemical compound with the molecular formula C12H12ClN3O2 and a molecular weight of 265.69 g/mol. IUPAC name: ethyl 1-(4-chlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylate. InChIKey: DHKXSWNZIIIRMH-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O2 |
|---|---|
| Molecular weight | 265.69 g/mol |
| IUPAC name | ethyl 1-(4-chlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylate |
| InChIKey | DHKXSWNZIIIRMH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C(=N1)C)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)