Products 1150164-74-1
CAS 1150164-74-1 is the registry number for Ethyl 1-(6-chloropyridin-2-yl)-5-methyl-1H-pyrazole-4-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Ethyl 1-(6-chloro-2-pyridinyl)-5-methylpyrazole-4-carboxylate (CAS 1150164-74-1) is a chemical compound with the molecular formula C12H12ClN3O2 and a molecular weight of 265.69 g/mol. IUPAC name: ethyl 1-(6-chloro-2-pyridinyl)-5-methylpyrazole-4-carboxylate. InChIKey: WYPKZNBFIJVYDA-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O2 |
|---|---|
| Molecular weight | 265.69 g/mol |
| IUPAC name | ethyl 1-(6-chloro-2-pyridinyl)-5-methylpyrazole-4-carboxylate |
| InChIKey | WYPKZNBFIJVYDA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=NC(=CC=C2)Cl)C |
Computed by PubChem (NCBI)