Products 1326844-91-0
CAS 1326844-91-0 is the registry number for 1-(4-Chloro-3-methylphenyl)-5-ethyl-1h-1,2,3-triazole-4-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(4-chloro-3-methylphenyl)-5-ethyltriazole-4-carboxylic acid (CAS 1326844-91-0) is a chemical compound with the molecular formula C12H12ClN3O2 and a molecular weight of 265.69 g/mol. IUPAC name: 1-(4-chloro-3-methylphenyl)-5-ethyltriazole-4-carboxylic acid. InChIKey: QGLNXYWGCVNGNT-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O2 |
|---|---|
| Molecular weight | 265.69 g/mol |
| IUPAC name | 1-(4-chloro-3-methylphenyl)-5-ethyltriazole-4-carboxylic acid |
| InChIKey | QGLNXYWGCVNGNT-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=NN1C2=CC(=C(C=C2)Cl)C)C(=O)O |
Computed by PubChem (NCBI)