Products 115055-21-5
CAS 115055-21-5 is the registry number for 2-[4-(2-Hydroxy-2-methyl-1-oxopropyl)phenoxy]ethyl 2-methyl-2-propenoate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl 2-methylprop-2-enoate (CAS 115055-21-5) is a chemical compound with the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. IUPAC name: 2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl 2-methylprop-2-enoate. InChIKey: AWELXMXBBYAGPS-UHFFFAOYSA-N.
| Molecular formula | C16H20O5 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | 2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl 2-methylprop-2-enoate |
| InChIKey | AWELXMXBBYAGPS-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCOC1=CC=C(C=C1)C(=O)C(C)(C)O |
Computed by PubChem (NCBI)