CAS 122005-20-3 is the registry number for 6-acetoxy-2,5,7,8-tetramethylchromane-2-carboxylic acid. Offered by: TRC. Available pack sizes: 250mg.
6-acetyloxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid (CAS 122005-20-3) is a chemical compound with the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. IUPAC name: 6-acetyloxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid. InChIKey: CUHJERIEOYEEOS-UHFFFAOYSA-N.
| Molecular formula | C16H20O5 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | 6-acetyloxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid |
| InChIKey | CUHJERIEOYEEOS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(CC2)(C)C(=O)O)C)OC(=O)C)C |
Computed by PubChem (NCBI)