Products 1226134-54-8

CAS 1226134-54-8 is the registry number for Ethyl 4-(3-isopropyl-4-methoxyphenyl)-2,4-dioxobutanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 4-(4-methoxy-3-propan-2-ylphenyl)-2,4-dioxobutanoate (CAS 1226134-54-8) is a chemical compound with the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. IUPAC name: ethyl 4-(4-methoxy-3-propan-2-ylphenyl)-2,4-dioxobutanoate. InChIKey: MNBUSAFBTSRRKB-UHFFFAOYSA-N.

Identity
Molecular formulaC16H20O5
Molecular weight292.33 g/mol
IUPAC nameethyl 4-(4-methoxy-3-propan-2-ylphenyl)-2,4-dioxobutanoate
InChIKeyMNBUSAFBTSRRKB-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)CC(=O)C1=CC(=C(C=C1)OC)C(C)C

Computed by PubChem (NCBI)