CAS 2727061-41-6 is the registry number for rac Mono(2-ethyl-5-oxohexyl) Phthalate-13C6. Offered by: TRC. Available pack sizes: 25mg.
6-(2-ethyl-5-oxohexoxy)carbonyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid (CAS 2727061-41-6) is a chemical compound with the molecular formula C16H20O5 and a molecular weight of 298.28 g/mol. IUPAC name: 6-(2-ethyl-5-oxohexoxy)carbonyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid. InChIKey: HCWNFKHKKHNSSL-ANBMRESWSA-N.
| Molecular formula | C16H20O5 |
|---|---|
| Molecular weight | 298.28 g/mol |
| IUPAC name | 6-(2-ethyl-5-oxohexoxy)carbonyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid |
| InChIKey | HCWNFKHKKHNSSL-ANBMRESWSA-N |
| SMILES | CCC(CCC(=O)C)COC(=O)[13C]1=[13CH][13CH]=[13CH][13CH]=[13C]1C(=O)O |
Computed by PubChem (NCBI)