CAS 2426657-35-2 is the registry number for (S)-4-(tert-Butoxy)-2-((R)-2,3-dihydrobenzofuran-3-yl)-4-oxobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 2426657-35-2) is a chemical compound with the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. IUPAC name: (2S)-2-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: NGCGVZWAYYETSD-RYUDHWBXSA-N.
| Molecular formula | C16H20O5 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | (2S)-2-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | NGCGVZWAYYETSD-RYUDHWBXSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H]([C@H]1COC2=CC=CC=C12)C(=O)O |
Computed by PubChem (NCBI)