Products 1188265-06-6

CAS 1188265-06-6 is the registry number for Ethyl 7-(4-methoxyphenyl)-4,7-dioxoheptanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 7-(4-methoxyphenyl)-4,7-dioxoheptanoate (CAS 1188265-06-6) is a chemical compound with the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. IUPAC name: ethyl 7-(4-methoxyphenyl)-4,7-dioxoheptanoate. InChIKey: YJDWJNGBUQHLAP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H20O5
Molecular weight292.33 g/mol
IUPAC nameethyl 7-(4-methoxyphenyl)-4,7-dioxoheptanoate
InChIKeyYJDWJNGBUQHLAP-UHFFFAOYSA-N
SMILESCCOC(=O)CCC(=O)CCC(=O)C1=CC=C(C=C1)OC

Computed by PubChem (NCBI)