CAS 115070-72-9 is the registry number for Texaline. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(1,3-benzodioxol-5-yl)-2-pyridin-3-yl-1,3-oxazole (CAS 115070-72-9) is a chemical compound with the molecular formula C15H10N2O3 and a molecular weight of 266.25 g/mol. IUPAC name: 5-(1,3-benzodioxol-5-yl)-2-pyridin-3-yl-1,3-oxazole. InChIKey: SDHIXARCLVIOJM-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O3 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 5-(1,3-benzodioxol-5-yl)-2-pyridin-3-yl-1,3-oxazole |
| InChIKey | SDHIXARCLVIOJM-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=CN=C(O3)C4=CN=CC=C4 |
Computed by PubChem (NCBI)