Products 115144-41-7
CAS 115144-41-7 appears in our catalog under these names: (-)-Ecgonine-d3 Hydrochloride, Ecgonine-D3.HCl, Ecgonine-D3.HCl, 1mg/ml in Methanol (as free base). Offered by: TRC, Lipomed. Available pack sizes: 10mg, 1mg, 50mg, 100mg, 1ml.
(1R,2R,3S,5S)-3-hydroxy-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]octane-2-carboxylic acid;hydrochloride (CAS 115144-41-7) is a chemical compound with the molecular formula C9H16ClNO3 and a molecular weight of 224.70 g/mol. IUPAC name: (1R,2R,3S,5S)-3-hydroxy-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]octane-2-carboxylic acid;hydrochloride. InChIKey: HVWQTEPEBQYIFB-OMOZMKOBSA-N.
| Molecular formula | C9H16ClNO3 |
|---|---|
| Molecular weight | 224.70 g/mol |
| IUPAC name | (1R,2R,3S,5S)-3-hydroxy-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]octane-2-carboxylic acid;hydrochloride |
| InChIKey | HVWQTEPEBQYIFB-OMOZMKOBSA-N |
| SMILES | [2H]C([2H])([2H])N1[C@H]2CC[C@@H]1[C@H]([C@H](C2)O)C(=O)O.Cl |
Computed by PubChem (NCBI)