Products 5796-31-6
CAS 5796-31-6 appears in our catalog under these names: (-)-Ecgonine Hydrochloride, Ecgonine Hydrochloride, Ecgonine.HCl. Offered by: TRC, Mikromol, Lipomed, Biosynth. Available pack sizes: 500mg, 50mg, 25mg, 100mg, 10mg, 250mg.
(1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylic acid;hydrochloride (CAS 5796-31-6) is a chemical compound with the molecular formula C9H16ClNO3 and a molecular weight of 221.68 g/mol. IUPAC name: (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylic acid;hydrochloride. InChIKey: HVWQTEPEBQYIFB-PXXJPSRFSA-N.
| Molecular formula | C9H16ClNO3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylic acid;hydrochloride |
| InChIKey | HVWQTEPEBQYIFB-PXXJPSRFSA-N |
| SMILES | CN1[C@H]2CC[C@@H]1[C@H]([C@H](C2)O)C(=O)O.Cl |
Computed by PubChem (NCBI)