Products 1151512-25-2
CAS 1151512-25-2 appears in our catalog under these names: 4-Bromothieno(2,3-c)pyridine-2-carboxylic acid, 4-Bromothieno[2,3-c]pyridine-2-carboxylic acid, 95+%, 95+%, 4-Bromothieno[2,3-c]pyridine-2-carboxylic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 100mg, 1g, 50mg, 500mg.
4-bromothieno[2,3-c]pyridine-2-carboxylic acid (CAS 1151512-25-2) is a chemical compound with the molecular formula C8H4BrNO2S and a molecular weight of 258.09 g/mol. IUPAC name: 4-bromothieno[2,3-c]pyridine-2-carboxylic acid. InChIKey: BGKJZKJDJZNFMI-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2S |
|---|---|
| Molecular weight | 258.09 g/mol |
| IUPAC name | 4-bromothieno[2,3-c]pyridine-2-carboxylic acid |
| InChIKey | BGKJZKJDJZNFMI-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=CN=CC(=C21)Br)C(=O)O |
Computed by PubChem (NCBI)