CAS 19492-95-6 appears in our catalog under these names: 3–Bromo–5–nitrobenzo(b)thiophene, 3-Bromo-5-nitrobenzo[b]thiophene 97%, Benzo[b]thiophene,3-bromo-5-nitro-, 97%, 97%, 3-Bromo-5-nitrobenzo[b]thiophene, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-bromo-5-nitro-1-benzothiophene (CAS 19492-95-6) is a chemical compound with the molecular formula C8H4BrNO2S and a molecular weight of 258.09 g/mol. IUPAC name: 3-bromo-5-nitro-1-benzothiophene. InChIKey: GGRNMFMKEKDBNE-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2S |
|---|---|
| Molecular weight | 258.09 g/mol |
| IUPAC name | 3-bromo-5-nitro-1-benzothiophene |
| InChIKey | GGRNMFMKEKDBNE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=CS2)Br |
Computed by PubChem (NCBI)