Products 1935928-11-2

CAS 1935928-11-2 is the registry number for 5-Bromothieno[2,3-b]pyridine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-bromothieno[2,3-b]pyridine-3-carboxylic acid (CAS 1935928-11-2) is a chemical compound with the molecular formula C8H4BrNO2S and a molecular weight of 258.09 g/mol. IUPAC name: 5-bromothieno[2,3-b]pyridine-3-carboxylic acid. InChIKey: IYULGPBXHQTIFO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4BrNO2S
Molecular weight258.09 g/mol
IUPAC name5-bromothieno[2,3-b]pyridine-3-carboxylic acid
InChIKeyIYULGPBXHQTIFO-UHFFFAOYSA-N
SMILESC1=C(C=NC2=C1C(=CS2)C(=O)O)Br

Computed by PubChem (NCBI)