CAS 1935928-11-2 is the registry number for 5-Bromothieno[2,3-b]pyridine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromothieno[2,3-b]pyridine-3-carboxylic acid (CAS 1935928-11-2) is a chemical compound with the molecular formula C8H4BrNO2S and a molecular weight of 258.09 g/mol. IUPAC name: 5-bromothieno[2,3-b]pyridine-3-carboxylic acid. InChIKey: IYULGPBXHQTIFO-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2S |
|---|---|
| Molecular weight | 258.09 g/mol |
| IUPAC name | 5-bromothieno[2,3-b]pyridine-3-carboxylic acid |
| InChIKey | IYULGPBXHQTIFO-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=CS2)C(=O)O)Br |
Computed by PubChem (NCBI)