CAS 1187928-54-6 is the registry number for 7-Bromobenzo[d]thiazole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
7-bromo-1,3-benzothiazole-2-carboxylic acid (CAS 1187928-54-6) is a chemical compound with the molecular formula C8H4BrNO2S and a molecular weight of 258.09 g/mol. IUPAC name: 7-bromo-1,3-benzothiazole-2-carboxylic acid. InChIKey: UUHPYSFOZUWXIC-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2S |
|---|---|
| Molecular weight | 258.09 g/mol |
| IUPAC name | 7-bromo-1,3-benzothiazole-2-carboxylic acid |
| InChIKey | UUHPYSFOZUWXIC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)SC(=N2)C(=O)O |
Computed by PubChem (NCBI)