CAS 1782620-63-6 is the registry number for 3-Bromobenzo[c]isothiazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-2,1-benzothiazole-5-carboxylic acid (CAS 1782620-63-6) is a chemical compound with the molecular formula C8H4BrNO2S and a molecular weight of 258.09 g/mol. IUPAC name: 3-bromo-2,1-benzothiazole-5-carboxylic acid. InChIKey: QQUGQRIXZIMKTD-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2S |
|---|---|
| Molecular weight | 258.09 g/mol |
| IUPAC name | 3-bromo-2,1-benzothiazole-5-carboxylic acid |
| InChIKey | QQUGQRIXZIMKTD-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSC(=C2C=C1C(=O)O)Br |
Computed by PubChem (NCBI)