Products 1782620-63-6

CAS 1782620-63-6 is the registry number for 3-Bromobenzo[c]isothiazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-bromo-2,1-benzothiazole-5-carboxylic acid (CAS 1782620-63-6) is a chemical compound with the molecular formula C8H4BrNO2S and a molecular weight of 258.09 g/mol. IUPAC name: 3-bromo-2,1-benzothiazole-5-carboxylic acid. InChIKey: QQUGQRIXZIMKTD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4BrNO2S
Molecular weight258.09 g/mol
IUPAC name3-bromo-2,1-benzothiazole-5-carboxylic acid
InChIKeyQQUGQRIXZIMKTD-UHFFFAOYSA-N
SMILESC1=CC2=NSC(=C2C=C1C(=O)O)Br

Computed by PubChem (NCBI)