CAS 1430836-42-2 is the registry number for 2-Bromothieno[3,2-b]pyridine-7-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2-bromothieno[3,2-b]pyridine-7-carboxylic acid (CAS 1430836-42-2) is a chemical compound with the molecular formula C8H4BrNO2S and a molecular weight of 258.09 g/mol. IUPAC name: 2-bromothieno[3,2-b]pyridine-7-carboxylic acid. InChIKey: RPNPZQLOXLYJMX-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2S |
|---|---|
| Molecular weight | 258.09 g/mol |
| IUPAC name | 2-bromothieno[3,2-b]pyridine-7-carboxylic acid |
| InChIKey | RPNPZQLOXLYJMX-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C=C(SC2=C1C(=O)O)Br |
Computed by PubChem (NCBI)