CAS 115174-39-5 appears in our catalog under these names: Methyl 2-amino-5-phenyl-1,3-thiazole-4-carboxylate, 95%, Methyl 2-amino-5-phenylthiazole-4-carboxylate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 2-amino-5-phenyl-1,3-thiazole-4-carboxylate (CAS 115174-39-5) is a chemical compound with the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. IUPAC name: methyl 2-amino-5-phenyl-1,3-thiazole-4-carboxylate. InChIKey: FKNMSTRVGQEASS-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2S |
|---|---|
| Molecular weight | 234.28 g/mol |
| IUPAC name | methyl 2-amino-5-phenyl-1,3-thiazole-4-carboxylate |
| InChIKey | FKNMSTRVGQEASS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(SC(=N1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)