CAS 1151802-09-3 is the registry number for 8-Chloro-3-(2,2,2-trifluoroethoxy)-1,5-naphthyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-3-(2,2,2-trifluoroethoxy)-1,5-naphthyridine (CAS 1151802-09-3) is a chemical compound with the molecular formula C10H6ClF3N2O and a molecular weight of 262.61 g/mol. IUPAC name: 8-chloro-3-(2,2,2-trifluoroethoxy)-1,5-naphthyridine. InChIKey: UIZKTOKXRMJXPR-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF3N2O |
|---|---|
| Molecular weight | 262.61 g/mol |
| IUPAC name | 8-chloro-3-(2,2,2-trifluoroethoxy)-1,5-naphthyridine |
| InChIKey | UIZKTOKXRMJXPR-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C=C(C=NC2=C1Cl)OCC(F)(F)F |
Computed by PubChem (NCBI)