CAS 874766-68-4 is the registry number for 2-(3-Chlorophenyl)-5-(trifluoromethyl)-2,4-dihydro-3H-pyrazol-3-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chlorophenyl)-5-(trifluoromethyl)-4H-pyrazol-3-one (CAS 874766-68-4) is a chemical compound with the molecular formula C10H6ClF3N2O and a molecular weight of 262.61 g/mol. IUPAC name: 2-(3-chlorophenyl)-5-(trifluoromethyl)-4H-pyrazol-3-one. InChIKey: QHKPJBHSNHUPAD-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF3N2O |
|---|---|
| Molecular weight | 262.61 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-5-(trifluoromethyl)-4H-pyrazol-3-one |
| InChIKey | QHKPJBHSNHUPAD-UHFFFAOYSA-N |
| SMILES | C1C(=NN(C1=O)C2=CC(=CC=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)