CAS 24522-41-6 is the registry number for N-[4-Chloro-3-(trifluoromethyl)phenyl]-2-cyanoacetamide, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyanoacetamide (CAS 24522-41-6) is a chemical compound with the molecular formula C10H6ClF3N2O and a molecular weight of 262.61 g/mol. IUPAC name: N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyanoacetamide. InChIKey: YOSCREVIYGDSSP-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF3N2O |
|---|---|
| Molecular weight | 262.61 g/mol |
| IUPAC name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyanoacetamide |
| InChIKey | YOSCREVIYGDSSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)CC#N)C(F)(F)F)Cl |
Computed by PubChem (NCBI)