CAS 175205-63-7 appears in our catalog under these names: 3-(Chloromethyl)-5-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole, 95%, 3-(Chloromethyl)-5-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole, 95% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 10g, 5g, 1g.
3-(chloromethyl)-5-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole (CAS 175205-63-7) is a chemical compound with the molecular formula C10H6ClF3N2O and a molecular weight of 262.61 g/mol. IUPAC name: 3-(chloromethyl)-5-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole. InChIKey: INANILNLXTUPHD-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF3N2O |
|---|---|
| Molecular weight | 262.61 g/mol |
| IUPAC name | 3-(chloromethyl)-5-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
| InChIKey | INANILNLXTUPHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NC(=NO2)CCl |
Computed by PubChem (NCBI)