CAS 219773-96-3 appears in our catalog under these names: 4-Chloro-5-methoxy-2-(trifluoromethyl)quinazoline, 95%, 4–Chloro–5–methoxy–2–(trifluoromethyl)quinazoline. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
4-chloro-5-methoxy-2-(trifluoromethyl)quinazoline (CAS 219773-96-3) is a chemical compound with the molecular formula C10H6ClF3N2O and a molecular weight of 262.61 g/mol. IUPAC name: 4-chloro-5-methoxy-2-(trifluoromethyl)quinazoline. InChIKey: LKRMUFYBFMVGMA-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF3N2O |
|---|---|
| Molecular weight | 262.61 g/mol |
| IUPAC name | 4-chloro-5-methoxy-2-(trifluoromethyl)quinazoline |
| InChIKey | LKRMUFYBFMVGMA-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=NC(=N2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)