CAS 730976-60-0 is the registry number for 2-(Chloromethyl)-7-(trifluoromethyl)quinazolin-4(3H)-one, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2-(chloromethyl)-7-(trifluoromethyl)-3H-quinazolin-4-one (CAS 730976-60-0) is a chemical compound with the molecular formula C10H6ClF3N2O and a molecular weight of 262.61 g/mol. IUPAC name: 2-(chloromethyl)-7-(trifluoromethyl)-3H-quinazolin-4-one. InChIKey: IFSZOKPUYPFKLT-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF3N2O |
|---|---|
| Molecular weight | 262.61 g/mol |
| IUPAC name | 2-(chloromethyl)-7-(trifluoromethyl)-3H-quinazolin-4-one |
| InChIKey | IFSZOKPUYPFKLT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=C(NC2=O)CCl |
Computed by PubChem (NCBI)