Products 1152431-76-9

CAS 1152431-76-9 appears in our catalog under these names: 5-Methyl-2,1,3-benzoxadiazole-4-sulfonyl chloride, 95%, 5-Methylbenzo(c)(1,2,5)oxadiazole-4-sulfonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-methyl-2,1,3-benzoxadiazole-4-sulfonyl chloride (CAS 1152431-76-9) is a chemical compound with the molecular formula C7H5ClN2O3S and a molecular weight of 232.64 g/mol. IUPAC name: 5-methyl-2,1,3-benzoxadiazole-4-sulfonyl chloride. InChIKey: PNFIAAOCDDIDNX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClN2O3S
Molecular weight232.64 g/mol
IUPAC name5-methyl-2,1,3-benzoxadiazole-4-sulfonyl chloride
InChIKeyPNFIAAOCDDIDNX-UHFFFAOYSA-N
SMILESCC1=C(C2=NON=C2C=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)