CAS 1350521-74-2 appears in our catalog under these names: 5-(1H-Pyrazol-5-yl)furan-2-sulfonyl chloride, 95%, 5-(1H-Pyrazol-5-yl)furan-2-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.
5-(1H-pyrazol-5-yl)furan-2-sulfonyl chloride (CAS 1350521-74-2) is a chemical compound with the molecular formula C7H5ClN2O3S and a molecular weight of 232.64 g/mol. IUPAC name: 5-(1H-pyrazol-5-yl)furan-2-sulfonyl chloride. InChIKey: FCVPAGYFRDXMSS-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O3S |
|---|---|
| Molecular weight | 232.64 g/mol |
| IUPAC name | 5-(1H-pyrazol-5-yl)furan-2-sulfonyl chloride |
| InChIKey | FCVPAGYFRDXMSS-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)S(=O)(=O)Cl)C2=CC=NN2 |
Computed by PubChem (NCBI)