Products 1350521-74-2

CAS 1350521-74-2 appears in our catalog under these names: 5-(1H-Pyrazol-5-yl)furan-2-sulfonyl chloride, 95%, 5-(1H-Pyrazol-5-yl)furan-2-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-(1H-pyrazol-5-yl)furan-2-sulfonyl chloride (CAS 1350521-74-2) is a chemical compound with the molecular formula C7H5ClN2O3S and a molecular weight of 232.64 g/mol. IUPAC name: 5-(1H-pyrazol-5-yl)furan-2-sulfonyl chloride. InChIKey: FCVPAGYFRDXMSS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClN2O3S
Molecular weight232.64 g/mol
IUPAC name5-(1H-pyrazol-5-yl)furan-2-sulfonyl chloride
InChIKeyFCVPAGYFRDXMSS-UHFFFAOYSA-N
SMILESC1=C(OC(=C1)S(=O)(=O)Cl)C2=CC=NN2

Computed by PubChem (NCBI)