CAS 1240527-07-4 is the registry number for 3-Methyl-(1,2)oxazolo(5,4-b)pyridine-5-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride (CAS 1240527-07-4) is a chemical compound with the molecular formula C7H5ClN2O3S and a molecular weight of 232.64 g/mol. IUPAC name: 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride. InChIKey: JGKTYJARBKWGGM-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O3S |
|---|---|
| Molecular weight | 232.64 g/mol |
| IUPAC name | 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride |
| InChIKey | JGKTYJARBKWGGM-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C1C=C(C=N2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)