Products 1240527-07-4

CAS 1240527-07-4 is the registry number for 3-Methyl-(1,2)oxazolo(5,4-b)pyridine-5-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride (CAS 1240527-07-4) is a chemical compound with the molecular formula C7H5ClN2O3S and a molecular weight of 232.64 g/mol. IUPAC name: 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride. InChIKey: JGKTYJARBKWGGM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClN2O3S
Molecular weight232.64 g/mol
IUPAC name3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride
InChIKeyJGKTYJARBKWGGM-UHFFFAOYSA-N
SMILESCC1=NOC2=C1C=C(C=N2)S(=O)(=O)Cl

Computed by PubChem (NCBI)