Products 2505372-52-9
CAS 2505372-52-9 is the registry number for 5-Cyano-2-methoxypyridine-3-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-cyano-2-methoxypyridine-3-sulfonyl chloride (CAS 2505372-52-9) is a chemical compound with the molecular formula C7H5ClN2O3S and a molecular weight of 232.64 g/mol. IUPAC name: 5-cyano-2-methoxypyridine-3-sulfonyl chloride. InChIKey: LPDCIXNDUBVILF-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O3S |
|---|---|
| Molecular weight | 232.64 g/mol |
| IUPAC name | 5-cyano-2-methoxypyridine-3-sulfonyl chloride |
| InChIKey | LPDCIXNDUBVILF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=N1)C#N)S(=O)(=O)Cl |
Computed by PubChem (NCBI)