CAS 5800-59-9 appears in our catalog under these names: Diazoxide Impurity 4, 7-Chloro-2H-1,2,4-benzothiadiazin-3(4H)-one 1-1-Dioxide, 7-CHLORO-2H-BENZO[E][1,2,4]THIADIAZIN-3(4H)-ONE 1,1-DIOXIDE, 95%, 95%. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 1g, 100mg, 250mg.
7-chloro-1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-one (CAS 5800-59-9) is a chemical compound with the molecular formula C7H5ClN2O3S and a molecular weight of 232.64 g/mol. IUPAC name: 7-chloro-1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-one. InChIKey: SDCJBUKXFVQVKG-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O3S |
|---|---|
| Molecular weight | 232.64 g/mol |
| IUPAC name | 7-chloro-1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-one |
| InChIKey | SDCJBUKXFVQVKG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)S(=O)(=O)NC(=O)N2 |
Computed by PubChem (NCBI)