CAS 2138332-78-0 is the registry number for (2,1,3-Benzoxadiazol-5-yl)methanesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,1,3-benzoxadiazol-5-ylmethanesulfonyl chloride (CAS 2138332-78-0) is a chemical compound with the molecular formula C7H5ClN2O3S and a molecular weight of 232.64 g/mol. IUPAC name: 2,1,3-benzoxadiazol-5-ylmethanesulfonyl chloride. InChIKey: PJABDERKAGOGIH-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O3S |
|---|---|
| Molecular weight | 232.64 g/mol |
| IUPAC name | 2,1,3-benzoxadiazol-5-ylmethanesulfonyl chloride |
| InChIKey | PJABDERKAGOGIH-UHFFFAOYSA-N |
| SMILES | C1=CC2=NON=C2C=C1CS(=O)(=O)Cl |
Computed by PubChem (NCBI)