Products 1152493-76-9
CAS 1152493-76-9 is the registry number for 2-(3-Phenoxyphenyl)benzoxazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
2-(3-phenoxyphenyl)-1,3-benzoxazole (CAS 1152493-76-9) is a chemical compound with the molecular formula C19H13NO2 and a molecular weight of 287.3 g/mol. IUPAC name: 2-(3-phenoxyphenyl)-1,3-benzoxazole. InChIKey: KTNCDXQIGSZHBK-UHFFFAOYSA-N.
| Molecular formula | C19H13NO2 |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | 2-(3-phenoxyphenyl)-1,3-benzoxazole |
| InChIKey | KTNCDXQIGSZHBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C3=NC4=CC=CC=C4O3 |
Computed by PubChem (NCBI)